Products 496054-85-4

CAS 496054-85-4 is the registry number for [4-(4-Fluorobenzyl)piperidin-1-yl](oxo)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]-2-oxoacetic acid (CAS 496054-85-4) is a chemical compound with the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. IUPAC name: 2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]-2-oxoacetic acid. InChIKey: MLAQWXTWHSFELI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16FNO3
Molecular weight265.28 g/mol
IUPAC name2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]-2-oxoacetic acid
InChIKeyMLAQWXTWHSFELI-UHFFFAOYSA-N
SMILESC1CN(CCC1CC2=CC=C(C=C2)F)C(=O)C(=O)O

Computed by PubChem (NCBI)