cas: 32926-43-5 — see every product listed under this CAS number, including other names
N-Boc-N'-trityl-L-histidine, 99%, 99% (CAS 32926-43-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146D5-1g |
| cas | 32926-43-5 |
| size | 1g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 50g | 203.60 Pln | |
| Chemat | 100g | 338.00 Pln | |
| Chemat | 250g | 683.60 Pln | |
| Chemat | 500g | 1305.60 Pln | |
| Chemat | 1kg | 1427.60 Pln | |
| Chemat | 5kg | 7296.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-tritylimidazol-4-yl)propanoic acid (CAS 32926-43-5) is a chemical compound with the molecular formula C30H31N3O4 and a molecular weight of 497.6 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-tritylimidazol-4-yl)propanoic acid. InChIKey: OYXZPXVCRAAKCM-SANMLTNESA-N.
| Molecular formula | C30H31N3O4 |
|---|---|
| Molecular weight | 497.6 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-tritylimidazol-4-yl)propanoic acid |
| InChIKey | OYXZPXVCRAAKCM-SANMLTNESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)