cas: 32926-43-5 — see every product listed under this CAS number, including other names
boc-his(trt)-oh, 95% (CAS 32926-43-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 50g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045435-1G |
| cas | 32926-43-5 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 25g | 169.75 Pln | |
| Fluorochem | 50g | 263.47 Pln | |
| Fluorochem | 100g | 435.28 Pln | |
| Fluorochem | 500g | 1913.93 Pln | |
| Fluorochem | 1kg | 3731.00 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-tritylimidazol-4-yl)propanoic acid (CAS 32926-43-5) is a chemical compound with the molecular formula C30H31N3O4 and a molecular weight of 497.6 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-tritylimidazol-4-yl)propanoic acid. InChIKey: OYXZPXVCRAAKCM-SANMLTNESA-N.
| Molecular formula | C30H31N3O4 |
|---|---|
| Molecular weight | 497.6 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-tritylimidazol-4-yl)propanoic acid |
| InChIKey | OYXZPXVCRAAKCM-SANMLTNESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)