cas: 188975-88-4 — see every product listed under this CAS number, including other names
N-Boc-hexahydro-1H-azepin-4-one 95% (CAS 188975-88-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A244693-250mg |
| cas | 188975-88-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 409.31 Pln | |
| Ambeed | 100g | 1405.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A244693 |
Tert-butyl 4-oxoazepane-1-carboxylate (CAS 188975-88-4) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl 4-oxoazepane-1-carboxylate. InChIKey: PMLBUVZPRKXMOX-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl 4-oxoazepane-1-carboxylate |
| InChIKey | PMLBUVZPRKXMOX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(=O)CC1 |
Computed by PubChem (NCBI)