cas: 1907-65-9 — see every product listed under this CAS number, including other names
N-Butyl-4-methylbenzenesulfonamide, 97%, 97% (CAS 1907-65-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113EQO-5g |
| cas | 1907-65-9 |
| size | 5g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 174.80 Pln | |
| Chemat | 100g | 482.00 Pln | |
| Chemat | 500g | 1684.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-butyl-4-methylbenzenesulfonamide (CAS 1907-65-9) is a chemical compound with the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. IUPAC name: N-butyl-4-methylbenzenesulfonamide. InChIKey: RQUXYBHREKXNKT-UHFFFAOYSA-N.
| Molecular formula | C11H17NO2S |
|---|---|
| Molecular weight | 227.33 g/mol |
| IUPAC name | N-butyl-4-methylbenzenesulfonamide |
| InChIKey | RQUXYBHREKXNKT-UHFFFAOYSA-N |
| SMILES | CCCCNS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)