cas: 1907-65-9 — see every product listed under this CAS number, including other names
N-Butyl-4-methylbenzenesulfonamide, 98% (CAS 1907-65-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242968-25G |
| cas | 1907-65-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 206.20 Pln | |
| Fluorochem | 100g | 560.24 Pln | |
| Fluorochem | 500g | 2580.36 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
N-butyl-4-methylbenzenesulfonamide (CAS 1907-65-9) is a chemical compound with the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. IUPAC name: N-butyl-4-methylbenzenesulfonamide. InChIKey: RQUXYBHREKXNKT-UHFFFAOYSA-N.
| Molecular formula | C11H17NO2S |
|---|---|
| Molecular weight | 227.33 g/mol |
| IUPAC name | N-butyl-4-methylbenzenesulfonamide |
| InChIKey | RQUXYBHREKXNKT-UHFFFAOYSA-N |
| SMILES | CCCCNS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)