cas: 1159822-23-7 — see every product listed under this CAS number, including other names
N-Cbz-8-azabicyclo[3.2.1]octane-3-carboxylic acid, 97%, 97% (CAS 1159822-23-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111HBE-100mg |
| cas | 1159822-23-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1000.40 Pln | |
| Chemat | 250mg | 1557.20 Pln | |
| Chemat | 500mg | 2555.60 Pln | |
| Chemat | 1g | 3798.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
8-phenylmethoxycarbonyl-8-azabicyclo[3.2.1]octane-3-carboxylic acid (CAS 1159822-23-7) is a chemical compound with the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. IUPAC name: 8-phenylmethoxycarbonyl-8-azabicyclo[3.2.1]octane-3-carboxylic acid. InChIKey: GGRXHCDVNPOPQW-UHFFFAOYSA-N.
| Molecular formula | C16H19NO4 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | 8-phenylmethoxycarbonyl-8-azabicyclo[3.2.1]octane-3-carboxylic acid |
| InChIKey | GGRXHCDVNPOPQW-UHFFFAOYSA-N |
| SMILES | C1CC2CC(CC1N2C(=O)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)