cas: 1430474-30-8 — see every product listed under this CAS number, including other names
N-Cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 95%, 95% (CAS 1430474-30-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPUL-100mg |
| cas | 1430474-30-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1782.80 Pln | |
| Chemat | 250mg | 2819.60 Pln | |
| Chemat | 1g | 5574.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1430474-30-8) is a chemical compound with the molecular formula C18H28BNO2 and a molecular weight of 301.2 g/mol. IUPAC name: N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: VIXSWZLRMUSPFT-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO2 |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | VIXSWZLRMUSPFT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC3CCCCC3 |
Computed by PubChem (NCBI)