cas: 871269-07-7 — see every product listed under this CAS number, including other names
N-Ethyl 3-bromobenzenesulfonamide, 98%, 98% (CAS 871269-07-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115TVT-250mg |
| cas | 871269-07-7 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 496.40 Pln | |
| Chemat | 5g | 1370.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-N-ethylbenzenesulfonamide (CAS 871269-07-7) is a chemical compound with the molecular formula C8H10BrNO2S and a molecular weight of 264.14 g/mol. IUPAC name: 3-bromo-N-ethylbenzenesulfonamide. InChIKey: MADIDEQQKAOBFI-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO2S |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | 3-bromo-N-ethylbenzenesulfonamide |
| InChIKey | MADIDEQQKAOBFI-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)