cas: 1437794-42-7 — see every product listed under this CAS number, including other names
N-Ethyl 5-nitropicolinamide, 98% (CAS 1437794-42-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A367207-10g |
| cas | 1437794-42-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 5147.80 Pln | |
| AmBeed | 250mg | 681.94 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-ethyl-5-nitropyridine-2-carboxamide (CAS 1437794-42-7) is a chemical compound with the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. IUPAC name: N-ethyl-5-nitropyridine-2-carboxamide. InChIKey: HUBAHLOHRNATIV-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O3 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | N-ethyl-5-nitropyridine-2-carboxamide |
| InChIKey | HUBAHLOHRNATIV-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)