cas: 66375-90-4 — see every product listed under this CAS number, including other names
N-Ethyl-3-(4-pyridyl)aniline, ≥95%, ≥95% (CAS 66375-90-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IBLI-1g |
| cas | 66375-90-4 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2195.60 Pln | |
| Chemat | 5g | 6021.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
N-ethyl-3-pyridin-4-ylaniline (CAS 66375-90-4) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 198.26 g/mol. IUPAC name: N-ethyl-3-pyridin-4-ylaniline. InChIKey: RXSMICOBTGUPLS-UHFFFAOYSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | N-ethyl-3-pyridin-4-ylaniline |
| InChIKey | RXSMICOBTGUPLS-UHFFFAOYSA-N |
| SMILES | CCNC1=CC=CC(=C1)C2=CC=NC=C2 |
Computed by PubChem (NCBI)