cas: 162558-25-0 — see every product listed under this CAS number, including other names
N-Fmoc-N'-Boc-L-2,3-diaminopropionic acid, 98%, 98% (CAS 162558-25-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112T9K-250mg |
| cas | 162558-25-0 |
| size | 250mg |
| availability | 2500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 25g | 338.00 Pln | |
| Chemat | 50g | 587.60 Pln | |
| Chemat | 100g | 1062.80 Pln | |
| Chemat | 500g | 5073.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 162558-25-0) is a chemical compound with the molecular formula C23H26N2O6 and a molecular weight of 426.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: PKAUMAVONPSDRW-IBGZPJMESA-N.
| Molecular formula | C23H26N2O6 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | PKAUMAVONPSDRW-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)