cas: 845305-90-0 — see every product listed under this CAS number, including other names
N-Isopropyl 5-bromopicolinamide, 98%, 98% (CAS 845305-90-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119HVF-250mg |
| cas | 845305-90-0 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 986.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-N-propan-2-ylpyridine-2-carboxamide (CAS 845305-90-0) is a chemical compound with the molecular formula C9H11BrN2O and a molecular weight of 243.10 g/mol. IUPAC name: 5-bromo-N-propan-2-ylpyridine-2-carboxamide. InChIKey: OQBRIMFEDJWHMB-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 5-bromo-N-propan-2-ylpyridine-2-carboxamide |
| InChIKey | OQBRIMFEDJWHMB-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=NC=C(C=C1)Br |
Computed by PubChem (NCBI)