Products 2099056-22-9
CAS 2099056-22-9 appears in our catalog under these names: 5-Bromo-n,n,3-trimethylpicolinamide, 95%, 5-Bromo-N,N,3-trimethylpicolinamide, 98%, 5-Bromo-N,N,3-trimethylpicolinamide, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-bromo-N,N,3-trimethylpyridine-2-carboxamide (CAS 2099056-22-9) is a chemical compound with the molecular formula C9H11BrN2O and a molecular weight of 243.10 g/mol. IUPAC name: 5-bromo-N,N,3-trimethylpyridine-2-carboxamide. InChIKey: AXYCUMYFOHRKDS-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 5-bromo-N,N,3-trimethylpyridine-2-carboxamide |
| InChIKey | AXYCUMYFOHRKDS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C(=O)N(C)C)Br |
Computed by PubChem (NCBI)