CAS 104290-45-1 appears in our catalog under these names: Isopropyl 5-bromonicotinamide, 95%, 5-Bromo-N-isopropylnicotinamide, 95%, 5-Bromo-N-isopropylnicotinamide. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 5g, 1g.
5-bromo-N-propan-2-ylpyridine-3-carboxamide (CAS 104290-45-1) is a chemical compound with the molecular formula C9H11BrN2O and a molecular weight of 243.10 g/mol. IUPAC name: 5-bromo-N-propan-2-ylpyridine-3-carboxamide. InChIKey: IONIYOWDLSXKNQ-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 5-bromo-N-propan-2-ylpyridine-3-carboxamide |
| InChIKey | IONIYOWDLSXKNQ-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)