cas: 173999-19-4 — see every product listed under this CAS number, including other names
N-Methyl 5-bromopyridine-3-sulfonamide, 96%, 96% (CAS 173999-19-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112ZCX-100mg |
| cas | 173999-19-4 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 333.20 Pln | |
| Chemat | 5g | 1182.80 Pln | |
| Chemat | 10g | 1965.20 Pln | |
| Chemat | 25g | 3866.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
5-bromo-N-methylpyridine-3-sulfonamide (CAS 173999-19-4) is a chemical compound with the molecular formula C6H7BrN2O2S and a molecular weight of 251.10 g/mol. IUPAC name: 5-bromo-N-methylpyridine-3-sulfonamide. InChIKey: SNFZSCOGEYEYJG-UHFFFAOYSA-N.
| Molecular formula | C6H7BrN2O2S |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | 5-bromo-N-methylpyridine-3-sulfonamide |
| InChIKey | SNFZSCOGEYEYJG-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)