cas: 56222-08-3 — see every product listed under this CAS number, including other names
N-Methyl-1-(2-nitrophenyl)methanamine 95% (CAS 56222-08-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A648757-100mg |
| cas | 56222-08-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 531.69 Pln | |
| Ambeed | 25g | 1683.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A648757 |
N-methyl-1-(2-nitrophenyl)methanamine (CAS 56222-08-3) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: N-methyl-1-(2-nitrophenyl)methanamine. InChIKey: WGILVXQNSFDASI-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | N-methyl-1-(2-nitrophenyl)methanamine |
| InChIKey | WGILVXQNSFDASI-UHFFFAOYSA-N |
| SMILES | CNCC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)