cas: 56222-08-3 — see every product listed under this CAS number, including other names
N-Methyl-1-(2-nitrophenyl)methanamine, 95% (CAS 56222-08-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F232690-1G |
| cas | 56222-08-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 476.93 Pln | |
| Fluorochem | 10g | 893.45 Pln | |
| Fluorochem | 25g | 1528.65 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
N-methyl-1-(2-nitrophenyl)methanamine (CAS 56222-08-3) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: N-methyl-1-(2-nitrophenyl)methanamine. InChIKey: WGILVXQNSFDASI-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | N-methyl-1-(2-nitrophenyl)methanamine |
| InChIKey | WGILVXQNSFDASI-UHFFFAOYSA-N |
| SMILES | CNCC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)