cas: 1313738-91-8 — see every product listed under this CAS number, including other names
N-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinamide, 97%, 97% (CAS 1313738-91-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 50g, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110D31-100mg |
| cas | 1313738-91-8 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 50g | 1576.40 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 500mg | 102.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 434.00 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 100g | 2819.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide (CAS 1313738-91-8) is a chemical compound with the molecular formula C13H19BN2O3 and a molecular weight of 262.11 g/mol. IUPAC name: N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide. InChIKey: HPVYZHWJBWMPHQ-UHFFFAOYSA-N.
| Molecular formula | C13H19BN2O3 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide |
| InChIKey | HPVYZHWJBWMPHQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)C(=O)NC |
Computed by PubChem (NCBI)