cas: 953040-54-5 — see every product listed under this CAS number, including other names
N-Methylpyrrole-3-boronic acid pinacol ester 97% (CAS 953040-54-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A581232-250mg |
| cas | 953040-54-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 548.38 Pln | |
| Ambeed | 25g | 2445.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A581232 |
1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (CAS 953040-54-5) is a chemical compound with the molecular formula C11H18BNO2 and a molecular weight of 207.08 g/mol. IUPAC name: 1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole. InChIKey: SYAMJGBBLFTQTK-UHFFFAOYSA-N.
| Molecular formula | C11H18BNO2 |
|---|---|
| Molecular weight | 207.08 g/mol |
| IUPAC name | 1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
| InChIKey | SYAMJGBBLFTQTK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C=C2)C |
Computed by PubChem (NCBI)