cas: 953040-54-5 — see every product listed under this CAS number, including other names
N-Methylpyrrole-3-boronic acid pinacol ester, 95% (CAS 953040-54-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 441000010 |
| cas | 953040-54-5 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 761.71 Pln | |
| Thermo Scientific (Acros) | 5g | 3046.84 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (CAS 953040-54-5) is a chemical compound with the molecular formula C11H18BNO2 and a molecular weight of 207.08 g/mol. IUPAC name: 1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole. InChIKey: SYAMJGBBLFTQTK-UHFFFAOYSA-N.
| Molecular formula | C11H18BNO2 |
|---|---|
| Molecular weight | 207.08 g/mol |
| IUPAC name | 1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
| InChIKey | SYAMJGBBLFTQTK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C=C2)C |
Computed by PubChem (NCBI)