cas: 1508-46-9 — see every product listed under this CAS number, including other names
N-Methylscopinium bromide, 95%, 95% (CAS 1508-46-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AE2F-1g |
| cas | 1508-46-9 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 10624.40 Pln | |
| Chemat | 5g | 31720.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-ol bromide (CAS 1508-46-9) is a chemical compound with the molecular formula C9H16BrNO2 and a molecular weight of 250.13 g/mol. IUPAC name: 9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-ol bromide. InChIKey: IKDFZBCJDLZSNH-UHFFFAOYSA-M.
| Molecular formula | C9H16BrNO2 |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-ol bromide |
| InChIKey | IKDFZBCJDLZSNH-UHFFFAOYSA-M |
| SMILES | C[N+]1(C2CC(CC1C3C2O3)O)C.[Br-] |
Computed by PubChem (NCBI)