cas: 874288-40-1 — see every product listed under this CAS number, including other names
N-Phenyl 4-borono-2-fluorobenzamide, 95%, 95% (CAS 874288-40-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GSYK-250mg |
| cas | 874288-40-1 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 770.00 Pln | |
| Chemat | 1g | 2555.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[3-fluoro-4-(phenylcarbamoyl)phenyl]boronic acid (CAS 874288-40-1) is a chemical compound with the molecular formula C13H11BFNO3 and a molecular weight of 259.04 g/mol. IUPAC name: [3-fluoro-4-(phenylcarbamoyl)phenyl]boronic acid. InChIKey: FVSONGWHQODJHA-UHFFFAOYSA-N.
| Molecular formula | C13H11BFNO3 |
|---|---|
| Molecular weight | 259.04 g/mol |
| IUPAC name | [3-fluoro-4-(phenylcarbamoyl)phenyl]boronic acid |
| InChIKey | FVSONGWHQODJHA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)NC2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)