cas: 608523-94-0 — see every product listed under this CAS number, including other names
N-tert-Butyl 3-Aminophenylsulfonamide 98% (CAS 608523-94-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A107312-250mg |
| cas | 608523-94-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1171.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A107312 |
3-amino-N-tert-butylbenzenesulfonamide (CAS 608523-94-0) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: 3-amino-N-tert-butylbenzenesulfonamide. InChIKey: KLQVFEHOLLUULE-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 3-amino-N-tert-butylbenzenesulfonamide |
| InChIKey | KLQVFEHOLLUULE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)