cas: 608523-94-0 — see every product listed under this CAS number, including other names
N-tert-Butyl 3-Aminophenylsulfonamide, 97%, 97% (CAS 608523-94-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TCW-250mg |
| cas | 608523-94-0 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 10g | 357.20 Pln | |
| Chemat | 25g | 678.80 Pln | |
| Chemat | 100mg | 78.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-amino-N-tert-butylbenzenesulfonamide (CAS 608523-94-0) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: 3-amino-N-tert-butylbenzenesulfonamide. InChIKey: KLQVFEHOLLUULE-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 3-amino-N-tert-butylbenzenesulfonamide |
| InChIKey | KLQVFEHOLLUULE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)