Products 91325-46-1
CAS 91325-46-1 appears in our catalog under these names: N1,N2-Bis(2,4,6-trimethylphenyl)ethanediamide, 95%, 95%, N1,N2-Dimesityloxalamide, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
N,N'-bis(2,4,6-trimethylphenyl)oxamide (CAS 91325-46-1) is a chemical compound with the molecular formula C20H24N2O2 and a molecular weight of 324.4 g/mol. IUPAC name: N,N'-bis(2,4,6-trimethylphenyl)oxamide. InChIKey: BYFNZGDOKWBBEN-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | N,N'-bis(2,4,6-trimethylphenyl)oxamide |
| InChIKey | BYFNZGDOKWBBEN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC(=O)C(=O)NC2=C(C=C(C=C2C)C)C)C |
Computed by PubChem (NCBI)