Products 1267657-68-0
CAS 1267657-68-0 appears in our catalog under these names: Quinidine-d3, Quinidine-d3, >95% (HPLC), Quinidine–d3. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: on request, 2,5mg, 25mg, 1mg, 5mg, 10mg, 50mg, 2.5 mg.
(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-[6-(trideuteriomethoxy)quinolin-4-yl]methanol (CAS 1267657-68-0) is a chemical compound with the molecular formula C20H24N2O2 and a molecular weight of 327.4 g/mol. IUPAC name: (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-[6-(trideuteriomethoxy)quinolin-4-yl]methanol. InChIKey: LOUPRKONTZGTKE-QMROFPFZSA-N.
| Molecular formula | C20H24N2O2 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-[6-(trideuteriomethoxy)quinolin-4-yl]methanol |
| InChIKey | LOUPRKONTZGTKE-QMROFPFZSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=CN=C2C=C1)[C@@H]([C@H]3C[C@@H]4CCN3C[C@@H]4C=C)O |
Computed by PubChem (NCBI)