Products 572-59-8
CAS 572-59-8 appears in our catalog under these names: 2,3,4,6-tetraacetate-alpha-D-Glucopyranosyl bromide, 9-epi-Quinidine, >95% (HPLC), Epiquinidine, Epiquinidine, 98.99%, Epiquinidine, 98%. Offered by: Creative Peptides, TRC, GLPBio, MedChemExpress, Fluorochem. Available pack sizes: on request, 25mg, 5mg, 1mg, 10mg, 10 mg, 5 mg.
(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (CAS 572-59-8) is a chemical compound with the molecular formula C20H24N2O2 and a molecular weight of 324.4 g/mol. IUPAC name: (R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol. InChIKey: LOUPRKONTZGTKE-AFHBHXEDSA-N.
| Molecular formula | C20H24N2O2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| InChIKey | LOUPRKONTZGTKE-AFHBHXEDSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)[C@H]([C@H]3C[C@@H]4CCN3C[C@@H]4C=C)O |
Computed by PubChem (NCBI)