cas: 10239-34-6 — see every product listed under this CAS number, including other names
N1,N3-Dibenzylpropane-1,3-diamine, 95% (CAS 10239-34-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224542-5G |
| cas | 10239-34-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 237.43 Pln | |
| Fluorochem | 25g | 419.66 Pln | |
| Fluorochem | 100g | 1481.79 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
N,N'-dibenzylpropane-1,3-diamine (CAS 10239-34-6) is a chemical compound with the molecular formula C17H22N2 and a molecular weight of 254.37 g/mol. IUPAC name: N,N'-dibenzylpropane-1,3-diamine. InChIKey: RXLUOFXICZSZIB-UHFFFAOYSA-N.
| Molecular formula | C17H22N2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | N,N'-dibenzylpropane-1,3-diamine |
| InChIKey | RXLUOFXICZSZIB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNCCCNCC2=CC=CC=C2 |
Computed by PubChem (NCBI)