CAS 4073-98-7 appears in our catalog under these names: 4,4'-Methylenebis(2,6-dimethylaniline), 98%, 4,4–Methylenebis(2,6–dimethylaniline), 4,4'-Methylenebis(2,6-dimethylaniline), >98.0%(HPLC)(T), 4,4'-Methylenebis(2,6-dimethylaniline), 4,4-Methylenebis(2,6-dimethylaniline) 97%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 25g, 5g, 100g, 1g, 0,1kg, 0,25kg, 0,5kg, 1kg.
4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline (CAS 4073-98-7) is a chemical compound with the molecular formula C17H22N2 and a molecular weight of 254.37 g/mol. IUPAC name: 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline. InChIKey: OMHOXRVODFQGCA-UHFFFAOYSA-N.
| Molecular formula | C17H22N2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline |
| InChIKey | OMHOXRVODFQGCA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C)CC2=CC(=C(C(=C2)C)N)C |
Computed by PubChem (NCBI)