CAS 5339-30-0 appears in our catalog under these names: 4-(4-Amino-2,5-dimethylbenzyl)-2,5-dimethylaniline, 95%, 4,4'-Methylenebis(2,5-dimethylaniline), 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-[(4-amino-2,5-dimethylphenyl)methyl]-2,5-dimethylaniline (CAS 5339-30-0) is a chemical compound with the molecular formula C17H22N2 and a molecular weight of 254.37 g/mol. IUPAC name: 4-[(4-amino-2,5-dimethylphenyl)methyl]-2,5-dimethylaniline. InChIKey: IHUCOFCWZZXKSE-UHFFFAOYSA-N.
| Molecular formula | C17H22N2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | 4-[(4-amino-2,5-dimethylphenyl)methyl]-2,5-dimethylaniline |
| InChIKey | IHUCOFCWZZXKSE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N)C)CC2=C(C=C(C(=C2)C)N)C |
Computed by PubChem (NCBI)