cas: 660838-05-1 — see every product listed under this CAS number, including other names
N1-Boc-4-methyl-1,3-phenylenediamine 97% (CAS 660838-05-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A355779-250mg |
| cas | 660838-05-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 887.69 Pln | |
| Ambeed | 25g | 3151.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A355779 |
Tert-butyl N-(3-amino-4-methylphenyl)carbamate (CAS 660838-05-1) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: tert-butyl N-(3-amino-4-methylphenyl)carbamate. InChIKey: HOVDUPXBRBXFBP-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | tert-butyl N-(3-amino-4-methylphenyl)carbamate |
| InChIKey | HOVDUPXBRBXFBP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)