CAS 608527-58-8 appears in our catalog under these names: N3,N3,N6,N6-Tetraphenyl-9H-carbazole-3,6-diamine, 97%, 97%, N3,N3,N6,N6-tetraphenyl-9H-carbazole-3,6-diamine, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.
3-N,3-N,6-N,6-N-tetraphenyl-9H-carbazole-3,6-diamine (CAS 608527-58-8) is a chemical compound with the molecular formula C36H27N3 and a molecular weight of 501.6 g/mol. IUPAC name: 3-N,3-N,6-N,6-N-tetraphenyl-9H-carbazole-3,6-diamine. InChIKey: GDKWMINSMJKPRT-UHFFFAOYSA-N.
| Molecular formula | C36H27N3 |
|---|---|
| Molecular weight | 501.6 g/mol |
| IUPAC name | 3-N,3-N,6-N,6-N-tetraphenyl-9H-carbazole-3,6-diamine |
| InChIKey | GDKWMINSMJKPRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC4=C(C=C3)NC5=C4C=C(C=C5)N(C6=CC=CC=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)