N3-PEG4-C2-NH2 95%
cas: 951671-92-4 — see every product listed under this CAS number, including other names
N3-PEG4-C2-NH2 95% (CAS 951671-92-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A527183-100mg |
| cas | 951671-92-4 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1049.00 Pln | |
| Ambeed | 10g | 1872.25 Pln | |
| Ambeed | 25g | 3185.00 Pln | |
| Ambeed | 100g | 10978.06 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A527183 |
2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanamine (CAS 951671-92-4) is a chemical compound with the molecular formula C10H22N4O4 and a molecular weight of 262.31 g/mol. IUPAC name: 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: ZMBGKXBIVYXREN-UHFFFAOYSA-N.
| Molecular formula | C10H22N4O4 |
|---|---|
| Molecular weight | 262.31 g/mol |
| IUPAC name | 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | ZMBGKXBIVYXREN-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCN=[N+]=[N-])N |
Computed by PubChem (NCBI)
Synonyms:
Azido-PEG4-Amine, 14-Azido-3,6,9,12-tetraoxatetradecan-1-amine, Amino-PEG4-azide, 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanamine, O-(2-Aminoethyl)-O'-(2-azidoethyl)triethylene Glycol, 14-Amino-3,6,9,12-tetraoxatetradecanyl Azide, 1-Amino-14-azido-3,6,9,12-tetraoxatetradecane, Azido-PEG4-NH2, Amino-PEG5-azide, O-(2-Aminoethyl)-O'-(2-azidoethyl)triethyleneGlycol