cas: 944251-24-5 — see every product listed under this CAS number, including other names
N3-PEG4-C2-NHS ester, 95% (CAS 944251-24-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554626-100MG |
| cas | 944251-24-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 877.83 Pln | |
| Fluorochem | 5g | 3736.20 Pln | |
| Fluorochem | 10g | 6375.90 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoate (CAS 944251-24-5) is a chemical compound with the molecular formula C15H24N4O8 and a molecular weight of 388.37 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: OIGKWPIMJCPGGD-UHFFFAOYSA-N.
| Molecular formula | C15H24N4O8 |
|---|---|
| Molecular weight | 388.37 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | OIGKWPIMJCPGGD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)