CAS 944251-24-5 appears in our catalog under these names: 3-Azido(peg4)propionic acid N-hydroxysuccinimide ester, 96%, N3–PEG4–C2–NHS ester, N3-PEG4-C2-NHS ester/ 99.85% (existing batch purity), N3-PEG(4)-NHS, N-Succinimidyl 15-azido-4,7,10,13-tetraoxapentadecanoate, 90. Offered by: Combi-blocks, GLPBio, TargetMol, Iris Biotech, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 250mg, 5g, 100mg, 50mg, 10mg, 25mg, 500mg.
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoate (CAS 944251-24-5) is a chemical compound with the molecular formula C15H24N4O8 and a molecular weight of 388.37 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: OIGKWPIMJCPGGD-UHFFFAOYSA-N.
| Molecular formula | C15H24N4O8 |
|---|---|
| Molecular weight | 388.37 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | OIGKWPIMJCPGGD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)