N6-(p-Hydroxyphenethyl)-Adenosine)
cas: 41552-94-7 — see every product listed under this CAS number, including other names
N6-(p-Hydroxyphenethyl)-Adenosine) (CAS 41552-94-7) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg. Offered by: TargetMol, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T60103-5mg |
| cas | 41552-94-7 |
| size | 5mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 5mg | 386.15 Pln | |
| TargetMol | 10mg | 478.94 Pln | |
| TargetMol | 25mg | 684.65 Pln | |
| TargetMol | 50mg | 923.91 Pln | |
| TargetMol | 100mg | 1282.22 Pln | |
| TargetMol | 200mg | 1833.40 Pln | |
| Chemat | 5mg | 304.40 Pln | |
| Chemat | 10mg | 429.20 Pln | |
| Chemat | 25mg | 712.40 Pln | |
| Chemat | 50mg | 1038.80 Pln | |
| Chemat | 100mg | 1638.80 Pln | |
| Chemat | 500mg | 7288.40 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 19 days |
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[2-(4-hydroxyphenyl)ethylamino]purin-9-yl]oxolane-3,4-diol (CAS 41552-94-7) is a chemical compound with the molecular formula C18H21N5O5 and a molecular weight of 387.4 g/mol. IUPAC name: (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[2-(4-hydroxyphenyl)ethylamino]purin-9-yl]oxolane-3,4-diol. InChIKey: PQXJDJJHXDEVFF-SCFUHWHPSA-N.
| Molecular formula | C18H21N5O5 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[2-(4-hydroxyphenyl)ethylamino]purin-9-yl]oxolane-3,4-diol |
| InChIKey | PQXJDJJHXDEVFF-SCFUHWHPSA-N |
| SMILES | C1=CC(=CC=C1CCNC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Platelet aggregation-IN-2, orb1301160