Products 41552-94-7
CAS 41552-94-7 appears in our catalog under these names: N6-(p-Hydroxyphenethyl)-Adenosine), Platelet aggregation-IN-2. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg, 50 mg.
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[2-(4-hydroxyphenyl)ethylamino]purin-9-yl]oxolane-3,4-diol (CAS 41552-94-7) is a chemical compound with the molecular formula C18H21N5O5 and a molecular weight of 387.4 g/mol. IUPAC name: (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[2-(4-hydroxyphenyl)ethylamino]purin-9-yl]oxolane-3,4-diol. InChIKey: PQXJDJJHXDEVFF-SCFUHWHPSA-N.
| Molecular formula | C18H21N5O5 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[2-(4-hydroxyphenyl)ethylamino]purin-9-yl]oxolane-3,4-diol |
| InChIKey | PQXJDJJHXDEVFF-SCFUHWHPSA-N |
| SMILES | C1=CC(=CC=C1CCNC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Platelet aggregation-IN-2, orb1301160