Products 104340-52-5
CAS 104340-52-5 appears in our catalog under these names: NC-1300-B/ 99.22% (existing batch purity), NEGXXYIOWVTFAE-UHFFFAOYSA-N. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
N,N-dimethyl-2-[(6-methyl-1H-benzimidazol-2-yl)sulfinylmethyl]aniline (CAS 104340-52-5) is a chemical compound with the molecular formula C17H19N3OS and a molecular weight of 313.4 g/mol. IUPAC name: N,N-dimethyl-2-[(6-methyl-1H-benzimidazol-2-yl)sulfinylmethyl]aniline. InChIKey: NEGXXYIOWVTFAE-UHFFFAOYSA-N.
| Molecular formula | C17H19N3OS |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | N,N-dimethyl-2-[(6-methyl-1H-benzimidazol-2-yl)sulfinylmethyl]aniline |
| InChIKey | NEGXXYIOWVTFAE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)S(=O)CC3=CC=CC=C3N(C)C |
Computed by PubChem (NCBI)