CAS 226878-01-9 appears in our catalog under these names: NPS 2390, NPS2390/ 99.24% (existing batch purity), NPS 2390, NPS 2390 98%, N-(Adamantan-1-yl)quinoxaline-2-carboxamide, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 200mg, 1mg, 250mg.
N-(1-adamantyl)quinoxaline-2-carboxamide (CAS 226878-01-9) is a chemical compound with the molecular formula C19H21N3O and a molecular weight of 307.4 g/mol. IUPAC name: N-(1-adamantyl)quinoxaline-2-carboxamide. InChIKey: ZKFVOZCCAXQXBU-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | N-(1-adamantyl)quinoxaline-2-carboxamide |
| InChIKey | ZKFVOZCCAXQXBU-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)NC(=O)C4=NC5=CC=CC=C5N=C4 |
Computed by PubChem (NCBI)