Products 184220-36-8
CAS 184220-36-8 appears in our catalog under these names: NS-2710/ 99.82% (existing batch purity), NS-2710, NS-2710, 99.21%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg, 10 mg.
(E)-N-ethoxy-1-[1-(3-pyridin-3-ylphenyl)benzimidazol-5-yl]ethanimine (CAS 184220-36-8) is a chemical compound with the molecular formula C22H20N4O and a molecular weight of 356.4 g/mol. IUPAC name: (E)-N-ethoxy-1-[1-(3-pyridin-3-ylphenyl)benzimidazol-5-yl]ethanimine. InChIKey: NHJFEXZXSCFYRX-PCLIKHOPSA-N.
| Molecular formula | C22H20N4O |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | (E)-N-ethoxy-1-[1-(3-pyridin-3-ylphenyl)benzimidazol-5-yl]ethanimine |
| InChIKey | NHJFEXZXSCFYRX-PCLIKHOPSA-N |
| SMILES | CCO/N=C(\C)/C1=CC2=C(C=C1)N(C=N2)C3=CC=CC(=C3)C4=CN=CC=C4 |
Computed by PubChem (NCBI)