CAS 59988-01-1 appears in our catalog under these names: NSC243928 mesylate, NSC243928 mesylate/ 99.39% (existing batch purity), NSC 243928 99%, N-(4-(Acridin-9-ylamino)-3-methoxyphenyl)ethanesulfonamide methanesulfonate, NSC243928 (mesylate), 99.28%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
N-[4-(acridin-9-ylamino)-3-methoxyphenyl]ethanesulfonamide;methanesulfonic acid (CAS 59988-01-1) is a chemical compound with the molecular formula C23H25N3O6S2 and a molecular weight of 503.6 g/mol. IUPAC name: N-[4-(acridin-9-ylamino)-3-methoxyphenyl]ethanesulfonamide;methanesulfonic acid. InChIKey: HPURJIOSFDKFBF-UHFFFAOYSA-N.
| Molecular formula | C23H25N3O6S2 |
|---|---|
| Molecular weight | 503.6 g/mol |
| IUPAC name | N-[4-(acridin-9-ylamino)-3-methoxyphenyl]ethanesulfonamide;methanesulfonic acid |
| InChIKey | HPURJIOSFDKFBF-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)NC1=CC(=C(C=C1)NC2=C3C=CC=CC3=NC4=CC=CC=C42)OC.CS(=O)(=O)O |
Computed by PubChem (NCBI)