cas: 82956-11-4 — see every product listed under this CAS number, including other names
Nafamostat mesylate, 98.00% (CAS 82956-11-4) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM51440P-10mg |
| cas | 82956-11-4 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 566.99 Pln | |
| Chemat | 50mg | 1192.46 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
(6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methanesulfonic acid (CAS 82956-11-4) is a chemical compound with the molecular formula C21H25N5O8S2 and a molecular weight of 539.6 g/mol. IUPAC name: (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methanesulfonic acid. InChIKey: SRXKIZXIRHMPFW-UHFFFAOYSA-N.
| Molecular formula | C21H25N5O8S2 |
|---|---|
| Molecular weight | 539.6 g/mol |
| IUPAC name | (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methanesulfonic acid |
| InChIKey | SRXKIZXIRHMPFW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.C1=CC(=CC=C1C(=O)OC2=CC3=C(C=C2)C=C(C=C3)C(=N)N)N=C(N)N |
Computed by PubChem (NCBI)