cas: 82956-11-4 — see every product listed under this CAS number, including other names
Nafamostat Mesylate(FUT–175) (CAS 82956-11-4) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 10mM (in 1ml dmso), 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC10613-10 |
| cas | 82956-11-4 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 550.23 Pln | |
| GLPBio | 100mg | 1079.13 Pln | |
| GLPBio | 25mg | 671.93 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 564.28 Pln | |
| GLPBio | 50mg | 831.06 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methanesulfonic acid (CAS 82956-11-4) is a chemical compound with the molecular formula C21H25N5O8S2 and a molecular weight of 539.6 g/mol. IUPAC name: (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methanesulfonic acid. InChIKey: SRXKIZXIRHMPFW-UHFFFAOYSA-N.
| Molecular formula | C21H25N5O8S2 |
|---|---|
| Molecular weight | 539.6 g/mol |
| IUPAC name | (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methanesulfonic acid |
| InChIKey | SRXKIZXIRHMPFW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.C1=CC(=CC=C1C(=O)OC2=CC3=C(C=C2)C=C(C=C3)C(=N)N)N=C(N)N |
Computed by PubChem (NCBI)