CAS 82956-11-4 appears in our catalog under these names: Nafamostat Mesylate, Nafamostat Mesylate, >95% (HPLC), Nafamostat mesylate/ 97.36% (existing batch purity), Nafamostat Mesylate(FUT–175), Nafamostat Mesylate, >98.0%(HPLC). Offered by: Chemat Brand, TRC, TargetMol, GLPBio, TCI. Available pack sizes: on request, 100mg, 10mg, 50mg, 25mg, 500mg, 10mM (in 1ml dmso), 20mg.
(6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methanesulfonic acid (CAS 82956-11-4) is a chemical compound with the molecular formula C21H25N5O8S2 and a molecular weight of 539.6 g/mol. IUPAC name: (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methanesulfonic acid. InChIKey: SRXKIZXIRHMPFW-UHFFFAOYSA-N.
| Molecular formula | C21H25N5O8S2 |
|---|---|
| Molecular weight | 539.6 g/mol |
| IUPAC name | (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate;methanesulfonic acid |
| InChIKey | SRXKIZXIRHMPFW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.C1=CC(=CC=C1C(=O)OC2=CC3=C(C=C2)C=C(C=C3)C(=N)N)N=C(N)N |
Computed by PubChem (NCBI)