cas: 91-96-3 — see every product listed under this CAS number, including other names
Naphtanilide G, 95%(HPLC),RG, 95%(HPLC),RG (CAS 91-96-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SG4-5g |
| cas | 91-96-3 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 170.00 Pln | |
| Chemat | 25g | 381.20 Pln |
| purity | 95%(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
N-[2-methyl-4-[3-methyl-4-(3-oxobutanoylamino)phenyl]phenyl]-3-oxobutanamide (CAS 91-96-3) is a chemical compound with the molecular formula C22H24N2O4 and a molecular weight of 380.4 g/mol. IUPAC name: N-[2-methyl-4-[3-methyl-4-(3-oxobutanoylamino)phenyl]phenyl]-3-oxobutanamide. InChIKey: CRRLDLPBQWRVGN-UHFFFAOYSA-N.
| Molecular formula | C22H24N2O4 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | N-[2-methyl-4-[3-methyl-4-(3-oxobutanoylamino)phenyl]phenyl]-3-oxobutanamide |
| InChIKey | CRRLDLPBQWRVGN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)NC(=O)CC(=O)C)C)NC(=O)CC(=O)C |
Computed by PubChem (NCBI)