CAS 1225276-23-2 is the registry number for P-Nitrophenyl 2-(m-methylphenyl)-7-aza-spiro[3.5]nonane-7-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.
(4-nitrophenyl) 2-(3-methylphenyl)-7-azaspiro[3.5]nonane-7-carboxylate (CAS 1225276-23-2) is a chemical compound with the molecular formula C22H24N2O4 and a molecular weight of 380.4 g/mol. IUPAC name: (4-nitrophenyl) 2-(3-methylphenyl)-7-azaspiro[3.5]nonane-7-carboxylate. InChIKey: ORGGXELYDKDENI-UHFFFAOYSA-N.
| Molecular formula | C22H24N2O4 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (4-nitrophenyl) 2-(3-methylphenyl)-7-azaspiro[3.5]nonane-7-carboxylate |
| InChIKey | ORGGXELYDKDENI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2CC3(C2)CCN(CC3)C(=O)OC4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)