CAS 221352-82-5 appears in our catalog under these names: Fmoc-4-amino-1-carboxymethyl-piperidine, 95%, Fmoc–4–amino–1–carboxymethyl–piperidine, Fmoc-4-APipAc-OH, 2-[4-({[(9h-fluoren-9-yl)methoxy]carbonyl}amino)piperidin-1-yl]acetic acid, 99.88%, 2-(4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)piperidin-1-yl)acetic acid, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 5g, 25g, 1 g, 500 mg, 250 mg.
2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidin-1-yl]acetic acid (CAS 221352-82-5) is a chemical compound with the molecular formula C22H24N2O4 and a molecular weight of 380.4 g/mol. IUPAC name: 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidin-1-yl]acetic acid. InChIKey: VLQJIWJYRZIBMP-UHFFFAOYSA-N.
| Molecular formula | C22H24N2O4 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidin-1-yl]acetic acid |
| InChIKey | VLQJIWJYRZIBMP-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)CC(=O)O |
Computed by PubChem (NCBI)