cas: 15448-58-5 — see every product listed under this CAS number, including other names
Naphtho[2,3-b]oxirene-2,7(1aH,7aH)-dione (CAS 15448-58-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ALAL-5mg |
| cas | 15448-58-5 |
| size | 5mg |
| availability | 0.075g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 688.40 Pln | |
| Chemat | 25mg | 1139.60 Pln |
| delivery time | 3 weeks |
|---|
1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione (CAS 15448-58-5) is a chemical compound with the molecular formula C10H6O3 and a molecular weight of 174.15 g/mol. IUPAC name: 1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione. InChIKey: TVVRFUOKLKGUKT-UHFFFAOYSA-N.
| Molecular formula | C10H6O3 |
|---|---|
| Molecular weight | 174.15 g/mol |
| IUPAC name | 1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione |
| InChIKey | TVVRFUOKLKGUKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3C(C2=O)O3 |
Computed by PubChem (NCBI)