Products 790673-00-6
CAS 790673-00-6 appears in our catalog under these names: Neosalvianen/ 99.09% (existing batch purity), Neosalvianen. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 10 mg, 5 mg.
5,9,17,17-tetramethyl-3,10-dioxa-8-azapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,7(11),8,13(18),19-heptaene (CAS 790673-00-6) is a chemical compound with the molecular formula C21H21NO2 and a molecular weight of 319.4 g/mol. IUPAC name: 5,9,17,17-tetramethyl-3,10-dioxa-8-azapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,7(11),8,13(18),19-heptaene. InChIKey: XIEAHUZPQQITDN-UHFFFAOYSA-N.
| Molecular formula | C21H21NO2 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 5,9,17,17-tetramethyl-3,10-dioxa-8-azapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,7(11),8,13(18),19-heptaene |
| InChIKey | XIEAHUZPQQITDN-UHFFFAOYSA-N |
| SMILES | CC1=COC2=C1C3=C(C4=C2C=CC5=C4CCCC5(C)C)OC(=N3)C |
Computed by PubChem (NCBI)